Urolithin B budada ugu fiican (1139-83-9) Soo saaraha & warshad

Budada Urolithin B

November 9, 2020

Urolithin BSmamnuucista

Name: Urolithin B
Magaca kiimikada: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-one
CAS: 1139-83-9
Caanaha Kiimikada: C13H8O3
Miisaankani waa: 212.2 g / mol
Color:  budo White
Keydka InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
NOLOSHADA SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
function: Urolithin B waxay hagaajin kartaa shaqada mitochondrial iyo shaqada muruqyada.

Urolithin B waxay hagaajin kartaa xoogga murqaha iyo adkeysiga inta lagu jiro da'da.

Codsiga: Urolithin B waa dheef-shiid kiimikaad maaddada microbial-ka ah ee loo yaqaan 'ellagitannis' wuxuuna muujiyaa firfircooni firfircoon oo ka-hortagga sunta-jirka iyo dhaqdhaqaaqa ka-hortagga jirka ee ku xiran nidaamka deynta iyo shuruudaha. Urolithin B sidoo kale waxay soo bandhigi kartaa waxqabadka estrogenic iyo / ama waxqabadka anti-estrogenic.
Xalka: Si fudud ayaa loogu millaayaa N, N-dimethylformamide iyo dimethylmethylene. Sulfone, oo waxoogaa ku milma methanol, ethanol, iyo ethyl acetate
Kaydinta Nabadgelyada: Hygroscopic, -20 ° C Qaboojiyaha, Ka hooseeya jawiga gudaha
Xaaladda Maraakiibta: Nadiifi heerkulbeegyada heerkulka sida kiimiko aan halis lahayn. Badeecadani waa mid xasilloon oo ku filan muddo toddobaadyo ah inta lagu jiro maraakiibta caadiga ah iyo wakhtiga lagu kharash gareeyo.

 

Urolithin B NMR Spectrum

Urolithin B (1139-83-9) - NMR Spectrum

 

Haddii aad u baahan tahay COA, MSDS, HNMR qayb kasta oo badeecad ah iyo macluumaad kale ah, fadlan la soo xiriir annaga maareeyaha suuq gaynta.